C17H27N3O2 — CID 144683469
N-ethyl-2,2,4,4-tetramethyl-N'-(5-methyl-2-pyridinyl)pentanediamide (PubChem CID 144683469) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-ethyl-2,2,4,4-tetramethyl-N'-(5-methyl-2-pyridinyl)pentanediamide.
| Compound Name | N-ethyl-2,2,4,4-tetramethyl-N'-(5-methyl-2-pyridinyl)pentanediamide |
|---|---|
| PubChem CID | 144683469 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-ethyl-2,2,4,4-tetramethyl-N'-(5-methyl-2-pyridinyl)pentanediamide |
| SMILES | CCNC(=O)C(C)(C)CC(C)(C)C(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C17H27N3O2/c1-7-18-14(21)16(3,4)11-17(5,6)15(22)20-13-9-8-12(2)10-19-13/h8-10H,7,11H2,1-6H3,(H,18,21)(H,19,20,22) |
| InChIKey | DHDNYSGUTLETQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |