About methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate
methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate (PubChem CID 144683805) has the molecular formula C17H24O2S
and a molecular weight of 292.44 g/mol. Its IUPAC name is methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate.
Molecular Properties
| Compound Name | methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate |
| PubChem CID | 144683805 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate |
| SMILES | CC#Cc1ccc(CCCCCC(=O)OC)cc1.CS |
| InChI | InChI=1S/C16H20O2.CH4S/c1-3-7-14-10-12-15(13-11-14)8-5-4-6-9-16(17)18-2;1-2/h10-13H,4-6,8-9H2,1-2H3;2H,1H3 |
| InChIKey | WGNUDTNZUSBTAK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate?
The IUPAC name of methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate (CID 144683805) is methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate.
What is the SMILES notation for methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate?
The canonical SMILES for methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate is CC#Cc1ccc(CCCCCC(=O)OC)cc1.CS.
What is the InChIKey of methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate?
The InChIKey is WGNUDTNZUSBTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O2.CH4S/c1-3-7-14-10-12-15(13-11-14)8-5-4-6-9-16(17)18-2;1-2/h10-13H,4-6,8-9H2,1-2H3;2H,1H3.
What are the key properties of methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate?
methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate has a molecular weight of 292.44 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;methyl 6-(4-prop-1-ynylphenyl)hexanoate is sourced from PubChem (CID 144683805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).