About N-propylprop-2-enimidoyl fluoride
N-propylprop-2-enimidoyl fluoride (PubChem CID 144683898) has the molecular formula C6H10FN
and a molecular weight of 115.15 g/mol. Its IUPAC name is N-propylprop-2-enimidoyl fluoride.
Molecular Properties
| Compound Name | N-propylprop-2-enimidoyl fluoride |
| PubChem CID | 144683898 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | N-propylprop-2-enimidoyl fluoride |
| SMILES | C=C/C(F)=N/CCC |
| InChI | InChI=1S/C6H10FN/c1-3-5-8-6(7)4-2/h4H,2-3,5H2,1H3/b8-6- |
| InChIKey | HQGQYWDTJKQJKK-VURMDHGXSA-N |
| XLogP | 1.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-propylprop-2-enimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylprop-2-enimidoyl fluoride?
The IUPAC name of N-propylprop-2-enimidoyl fluoride (CID 144683898) is N-propylprop-2-enimidoyl fluoride.
What is the SMILES notation for N-propylprop-2-enimidoyl fluoride?
The canonical SMILES for N-propylprop-2-enimidoyl fluoride is C=C/C(F)=N/CCC.
What is the InChIKey of N-propylprop-2-enimidoyl fluoride?
The InChIKey is HQGQYWDTJKQJKK-VURMDHGXSA-N. The full InChI is InChI=1S/C6H10FN/c1-3-5-8-6(7)4-2/h4H,2-3,5H2,1H3/b8-6-.
What are the key properties of N-propylprop-2-enimidoyl fluoride?
N-propylprop-2-enimidoyl fluoride has a molecular weight of 115.15 g/mol, XLogP of 1.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylprop-2-enimidoyl fluoride is sourced from PubChem (CID 144683898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).