About heptane;2-methyl-2,3-dihydro-1H-inden-5-ol
heptane;2-methyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 144683949) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is heptane;2-methyl-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | heptane;2-methyl-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 144683949 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | heptane;2-methyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC1Cc2ccc(O)cc2C1.CCCCCCC |
| InChI | InChI=1S/C10H12O.C7H16/c1-7-4-8-2-3-10(11)6-9(8)5-7;1-3-5-7-6-4-2/h2-3,6-7,11H,4-5H2,1H3;3-7H2,1-2H3 |
| InChIKey | VFMVEFYRPMHTOI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptane;2-methyl-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;2-methyl-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of heptane;2-methyl-2,3-dihydro-1H-inden-5-ol (CID 144683949) is heptane;2-methyl-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for heptane;2-methyl-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for heptane;2-methyl-2,3-dihydro-1H-inden-5-ol is CC1Cc2ccc(O)cc2C1.CCCCCCC.
What is the InChIKey of heptane;2-methyl-2,3-dihydro-1H-inden-5-ol?
The InChIKey is VFMVEFYRPMHTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C7H16/c1-7-4-8-2-3-10(11)6-9(8)5-7;1-3-5-7-6-4-2/h2-3,6-7,11H,4-5H2,1H3;3-7H2,1-2H3.
What are the key properties of heptane;2-methyl-2,3-dihydro-1H-inden-5-ol?
heptane;2-methyl-2,3-dihydro-1H-inden-5-ol has a molecular weight of 248.41 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;2-methyl-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 144683949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).