About 5-heptan-3-yl-2-methyl-1,3-benzothiazole
5-heptan-3-yl-2-methyl-1,3-benzothiazole (PubChem CID 144683993) has the molecular formula C15H21NS
and a molecular weight of 247.41 g/mol. Its IUPAC name is 5-heptan-3-yl-2-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-heptan-3-yl-2-methyl-1,3-benzothiazole |
| PubChem CID | 144683993 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 5-heptan-3-yl-2-methyl-1,3-benzothiazole |
| SMILES | CCCCC(CC)c1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C15H21NS/c1-4-6-7-12(5-2)13-8-9-15-14(10-13)16-11(3)17-15/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | MUQVPLUZEUSUND-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-heptan-3-yl-2-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-heptan-3-yl-2-methyl-1,3-benzothiazole?
The IUPAC name of 5-heptan-3-yl-2-methyl-1,3-benzothiazole (CID 144683993) is 5-heptan-3-yl-2-methyl-1,3-benzothiazole.
What is the SMILES notation for 5-heptan-3-yl-2-methyl-1,3-benzothiazole?
The canonical SMILES for 5-heptan-3-yl-2-methyl-1,3-benzothiazole is CCCCC(CC)c1ccc2sc(C)nc2c1.
What is the InChIKey of 5-heptan-3-yl-2-methyl-1,3-benzothiazole?
The InChIKey is MUQVPLUZEUSUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NS/c1-4-6-7-12(5-2)13-8-9-15-14(10-13)16-11(3)17-15/h8-10,12H,4-7H2,1-3H3.
What are the key properties of 5-heptan-3-yl-2-methyl-1,3-benzothiazole?
5-heptan-3-yl-2-methyl-1,3-benzothiazole has a molecular weight of 247.41 g/mol, XLogP of 5.29, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-heptan-3-yl-2-methyl-1,3-benzothiazole is sourced from PubChem (CID 144683993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).