C15H16N4O — CID 14468468
5-methoxy-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-6-amine (PubChem CID 14468468) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-methoxy-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-6-amine.
| Compound Name | 5-methoxy-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-6-amine |
|---|---|
| PubChem CID | 14468468 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-methoxy-8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-6-amine |
| SMILES | COc1ccc2c(ncc3c4c([nH]c32)CCNC4)c1N |
| InChI | InChI=1S/C15H16N4O/c1-20-12-3-2-8-14-10(7-18-15(8)13(12)16)9-6-17-5-4-11(9)19-14/h2-3,7,17,19H,4-6,16H2,1H3 |
| InChIKey | UHVNIUQDUABGDC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|