C16H22O — CID 14468495
trans-(3R,5R)-3,5-dimethyl-2-(1-phenylethyl)cyclohexan-1-one (PubChem CID 14468495) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-dimethyl-2-(1-phenylethyl)cyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3,5-dimethyl-2-(1-phenylethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 14468495 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | trans-(3R,5R)-3,5-dimethyl-2-(1-phenylethyl)cyclohexan-1-one |
| SMILES | CC(c1ccccc1)C1C(=O)C[C@H](C)C[C@H]1C |
| InChI | InChI=1S/C16H22O/c1-11-9-12(2)16(15(17)10-11)13(3)14-7-5-4-6-8-14/h4-8,11-13,16H,9-10H2,1-3H3/t11-,12-,13?,16?/m1/s1 |
| InChIKey | YRDIXOWOQXDBRR-LFOFOYIVSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |