C20H17FIN3O6 — CID 144685393
iodo 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]-3-[(2-oxo-3H-1,3,4-oxadiazole-5-carbonyl)amino]butanoate (PubChem CID 144685393) has the molecular formula C20H17FIN3O6 and a molecular weight of 541.27 g/mol. Its IUPAC name is iodo 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]-3-[(2-oxo-3H-1,3,4-oxadiazole-5-carbonyl)amino]butanoate.
| Compound Name | iodo 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]-3-[(2-oxo-3H-1,3,4-oxadiazole-5-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 144685393 |
| Molecular Formula | C20H17FIN3O6 |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | iodo 4-[4-(5-fluoro-2-methoxyphenyl)phenyl]-3-[(2-oxo-3H-1,3,4-oxadiazole-5-carbonyl)amino]butanoate |
| SMILES | COc1ccc(F)cc1-c1ccc(CC(CC(=O)OI)NC(=O)c2n[nH]c(=O)o2)cc1 |
| InChI | InChI=1S/C20H17FIN3O6/c1-29-16-7-6-13(21)9-15(16)12-4-2-11(3-5-12)8-14(10-17(26)31-22)23-18(27)19-24-25-20(28)30-19/h2-7,9,14H,8,10H2,1H3,(H,23,27)(H,25,28) |
| InChIKey | UFUIMCXKVYYETH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|