About 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine
4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine (PubChem CID 144687794) has the molecular formula C6H11OP
and a molecular weight of 130.13 g/mol. Its IUPAC name is 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine.
Molecular Properties
| Compound Name | 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine |
| PubChem CID | 144687794 |
| Molecular Formula | C6H11OP |
| Molecular Weight | 130.13 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine |
| SMILES | CC1=CC(C)OPC1 |
| InChI | InChI=1S/C6H11OP/c1-5-3-6(2)7-8-4-5/h3,6,8H,4H2,1-2H3 |
| InChIKey | YFKDVYJEYBCRRD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine?
The IUPAC name of 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine (CID 144687794) is 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine.
What is the SMILES notation for 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine?
The canonical SMILES for 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine is CC1=CC(C)OPC1.
What is the InChIKey of 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine?
The InChIKey is YFKDVYJEYBCRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11OP/c1-5-3-6(2)7-8-4-5/h3,6,8H,4H2,1-2H3.
What are the key properties of 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine?
4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine has a molecular weight of 130.13 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-3,6-dihydro-2H-oxaphosphinine is sourced from PubChem (CID 144687794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).