C24H31ClN8O2S — CID 144687997
N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[4-[2-(methylaminomethoxy)ethyl]piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 144687997) has the molecular formula C24H31ClN8O2S and a molecular weight of 531.09 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[4-[2-(methylaminomethoxy)ethyl]piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[4-[2-(methylaminomethoxy)ethyl]piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 144687997 |
| Molecular Formula | C24H31ClN8O2S |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[4-[2-(methylaminomethoxy)ethyl]piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | CNCOCCN1CCN(c2cc(Nc3ncc(C(=O)Nc4c(C)cccc4Cl)s3)nc(C)n2)CC1 |
| InChI | InChI=1S/C24H31ClN8O2S/c1-16-5-4-6-18(25)22(16)31-23(34)19-14-27-24(36-19)30-20-13-21(29-17(2)28-20)33-9-7-32(8-10-33)11-12-35-15-26-3/h4-6,13-14,26H,7-12,15H2,1-3H3,(H,31,34)(H,27,28,29,30) |
| InChIKey | CFVVOIYZCRVYAF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|