C19H11ClFN5S — CID 144688005
5-[6-chloro-5-[(4-fluorophenyl)sulfanylamino]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 144688005) has the molecular formula C19H11ClFN5S and a molecular weight of 395.85 g/mol. Its IUPAC name is 5-[6-chloro-5-[(4-fluorophenyl)sulfanylamino]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 5-[6-chloro-5-[(4-fluorophenyl)sulfanylamino]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 144688005 |
| Molecular Formula | C19H11ClFN5S |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 5-[6-chloro-5-[(4-fluorophenyl)sulfanylamino]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnn2ccc(-c3cnc(Cl)c(NSc4ccc(F)cc4)c3)cc12 |
| InChI | InChI=1S/C19H11ClFN5S/c20-19-17(25-27-16-3-1-15(21)2-4-16)7-13(10-23-19)12-5-6-26-18(8-12)14(9-22)11-24-26/h1-8,10-11,25H |
| InChIKey | NBNJUNBIPGPRSQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|