About ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane
ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane (PubChem CID 144688230) has the molecular formula C26H36ClNO4
and a molecular weight of 462.03 g/mol. Its IUPAC name is ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane.
Molecular Properties
| Compound Name | ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane |
| PubChem CID | 144688230 |
| Molecular Formula | C26H36ClNO4 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane |
| SMILES | CC.CCC.CCOC(=O)CN1C(=O)COC(c2ccc(C)cc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO4.C3H8.C2H6/c1-3-26-19(25)12-23-18(24)13-27-21(16-6-4-14(2)5-7-16)20(23)15-8-10-17(22)11-9-15;1-3-2;1-2/h4-11,20-21H,3,12-13H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | QLNOWAWHSYKQHM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane?
The IUPAC name of ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane (CID 144688230) is ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane.
What is the SMILES notation for ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane?
The canonical SMILES for ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane is CC.CCC.CCOC(=O)CN1C(=O)COC(c2ccc(C)cc2)C1c1ccc(Cl)cc1.
What is the InChIKey of ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane?
The InChIKey is QLNOWAWHSYKQHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO4.C3H8.C2H6/c1-3-26-19(25)12-23-18(24)13-27-21(16-6-4-14(2)5-7-16)20(23)15-8-10-17(22)11-9-15;1-3-2;1-2/h4-11,20-21H,3,12-13H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane?
ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane has a molecular weight of 462.03 g/mol, XLogP of 6.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-[3-(4-chlorophenyl)-2-(4-methylphenyl)-5-oxomorpholin-4-yl]acetate;propane is sourced from PubChem (CID 144688230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).