About chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal
chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal (PubChem CID 144688289) has the molecular formula C28H30Cl2FNO3
and a molecular weight of 518.46 g/mol. Its IUPAC name is chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal.
Molecular Properties
| Compound Name | chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal |
| PubChem CID | 144688289 |
| Molecular Formula | C28H30Cl2FNO3 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal |
| SMILES | CCCC(C=O)N1CCOC(Cc2ccc(F)cc2)C1=O.Clc1ccccc1.Clc1ccccc1 |
| InChI | InChI=1S/C16H20FNO3.2C6H5Cl/c1-2-3-14(11-19)18-8-9-21-15(16(18)20)10-12-4-6-13(17)7-5-12;2*7-6-4-2-1-3-5-6/h4-7,11,14-15H,2-3,8-10H2,1H3;2*1-5H |
| InChIKey | YKKFYXNYBQLSMS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal?
The IUPAC name of chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal (CID 144688289) is chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal.
What is the SMILES notation for chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal?
The canonical SMILES for chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal is CCCC(C=O)N1CCOC(Cc2ccc(F)cc2)C1=O.Clc1ccccc1.Clc1ccccc1.
What is the InChIKey of chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal?
The InChIKey is YKKFYXNYBQLSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FNO3.2C6H5Cl/c1-2-3-14(11-19)18-8-9-21-15(16(18)20)10-12-4-6-13(17)7-5-12;2*7-6-4-2-1-3-5-6/h4-7,11,14-15H,2-3,8-10H2,1H3;2*1-5H.
What are the key properties of chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal?
chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal has a molecular weight of 518.46 g/mol, XLogP of 6.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal is sourced from PubChem (CID 144688289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).