C28H30Cl2FNO3 — CID 144688289
chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal (PubChem CID 144688289) has the molecular formula C28H30Cl2FNO3 and a molecular weight of 518.46 g/mol. Its IUPAC name is chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal.
| Compound Name | chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal |
|---|---|
| PubChem CID | 144688289 |
| Molecular Formula | C28H30Cl2FNO3 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | chlorobenzene;2-[2-[(4-fluorophenyl)methyl]-3-oxomorpholin-4-yl]pentanal |
| SMILES | CCCC(C=O)N1CCOC(Cc2ccc(F)cc2)C1=O.Clc1ccccc1.Clc1ccccc1 |
| InChI | InChI=1S/C16H20FNO3.2C6H5Cl/c1-2-3-14(11-19)18-8-9-21-15(16(18)20)10-12-4-6-13(17)7-5-12;2*7-6-4-2-1-3-5-6/h4-7,11,14-15H,2-3,8-10H2,1H3;2*1-5H |
| InChIKey | YKKFYXNYBQLSMS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|