About cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one
cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one (PubChem CID 144688647) has the molecular formula C17H24N2O2S
and a molecular weight of 320.46 g/mol. Its IUPAC name is cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one |
| PubChem CID | 144688647 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one |
| SMILES | C1CCCCC1.CC1=NN(CC(=O)c2ccsc2)C(=O)[C@H]1C |
| InChI | InChI=1S/C11H12N2O2S.C6H12/c1-7-8(2)12-13(11(7)15)5-10(14)9-3-4-16-6-9;1-2-4-6-5-3-1/h3-4,6-7H,5H2,1-2H3;1-6H2/t7-;/m0./s1 |
| InChIKey | FPVYCOYKRPDRAI-FJXQXJEOSA-N |
| XLogP | 4.13 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one?
The IUPAC name of cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one (CID 144688647) is cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one.
What is the SMILES notation for cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one?
The canonical SMILES for cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one is C1CCCCC1.CC1=NN(CC(=O)c2ccsc2)C(=O)[C@H]1C.
What is the InChIKey of cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one?
The InChIKey is FPVYCOYKRPDRAI-FJXQXJEOSA-N. The full InChI is InChI=1S/C11H12N2O2S.C6H12/c1-7-8(2)12-13(11(7)15)5-10(14)9-3-4-16-6-9;1-2-4-6-5-3-1/h3-4,6-7H,5H2,1-2H3;1-6H2/t7-;/m0./s1.
What are the key properties of cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one?
cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one has a molecular weight of 320.46 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;(4S)-4,5-dimethyl-2-(2-oxo-2-thiophen-3-ylethyl)-4H-pyrazol-3-one is sourced from PubChem (CID 144688647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).