C19H23N3O4 — CID 144688684
5-[(E)-hex-3-en-3-yl]-1,5-dimethyl-3-(2-oxo-2-pyridin-3-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 144688684) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-[(E)-hex-3-en-3-yl]-1,5-dimethyl-3-(2-oxo-2-pyridin-3-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-hex-3-en-3-yl]-1,5-dimethyl-3-(2-oxo-2-pyridin-3-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 144688684 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 5-[(E)-hex-3-en-3-yl]-1,5-dimethyl-3-(2-oxo-2-pyridin-3-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C=C(\CC)C1(C)C(=O)N(C)C(=O)N(CC(=O)c2cccnc2)C1=O |
| InChI | InChI=1S/C19H23N3O4/c1-5-8-14(6-2)19(3)16(24)21(4)18(26)22(17(19)25)12-15(23)13-9-7-10-20-11-13/h7-11H,5-6,12H2,1-4H3/b14-8+ |
| InChIKey | ASFYSTYDXVENNR-RIYZIHGNSA-N |
| XLogP | 2.44 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|