C10H21NO — CID 144689023
1-(2-ethyloxan-2-yl)-N,N-dimethylmethanamine (PubChem CID 144689023) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is 1-(2-ethyloxan-2-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(2-ethyloxan-2-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 144689023 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 1-(2-ethyloxan-2-yl)-N,N-dimethylmethanamine |
| SMILES | CCC1(CN(C)C)CCCCO1 |
| InChI | InChI=1S/C10H21NO/c1-4-10(9-11(2)3)7-5-6-8-12-10/h4-9H2,1-3H3 |
| InChIKey | LAMMKIMAJMWHKF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |