C41H41F3N2O4 — CID 144689291
1-(2,3-dihydro-1H-inden-5-yl)-4-[2-[(dimethylamino)methyl]phenyl]butane-1,4-dione;1-(2,3-dihydro-1H-inden-5-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione (PubChem CID 144689291) has the molecular formula C41H41F3N2O4 and a molecular weight of 682.78 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-4-[2-[(dimethylamino)methyl]phenyl]butane-1,4-dione;1-(2,3-dihydro-1H-inden-5-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-4-[2-[(dimethylamino)methyl]phenyl]butane-1,4-dione;1-(2,3-dihydro-1H-inden-5-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione |
|---|---|
| PubChem CID | 144689291 |
| Molecular Formula | C41H41F3N2O4 |
| Molecular Weight | 682.78 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-4-[2-[(dimethylamino)methyl]phenyl]butane-1,4-dione;1-(2,3-dihydro-1H-inden-5-yl)-4-[3-(trifluoromethyl)-2-pyridinyl]butane-1,4-dione |
| SMILES | CN(C)Cc1ccccc1C(=O)CCC(=O)c1ccc2c(c1)CCC2.O=C(CCC(=O)c1ncccc1C(F)(F)F)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H25NO2.C19H16F3NO2/c1-23(2)15-19-6-3-4-9-20(19)22(25)13-12-21(24)18-11-10-16-7-5-8-17(16)14-18;20-19(21,22)15-5-2-10-23-18(15)17(25)9-8-16(24)14-7-6-12-3-1-4-13(12)11-14/h3-4,6,9-11,14H,5,7-8,12-13,15H2,1-2H3;2,5-7,10-11H,1,3-4,8-9H2 |
| InChIKey | DERYKMCCEUWIEM-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.78 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |