About 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane
1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane (PubChem CID 144689486) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane.
Molecular Properties
| Compound Name | 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane |
| PubChem CID | 144689486 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane |
| SMILES | CC.Cc1ccc(C(=O)CCCC(=O)c2ccc(C)o2)o1 |
| InChI | InChI=1S/C15H16O4.C2H6/c1-10-6-8-14(18-10)12(16)4-3-5-13(17)15-9-7-11(2)19-15;1-2/h6-9H,3-5H2,1-2H3;1-2H3 |
| InChIKey | MONMKJMDEAJQRP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane?
The IUPAC name of 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane (CID 144689486) is 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane.
What is the SMILES notation for 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane?
The canonical SMILES for 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane is CC.Cc1ccc(C(=O)CCCC(=O)c2ccc(C)o2)o1.
What is the InChIKey of 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane?
The InChIKey is MONMKJMDEAJQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4.C2H6/c1-10-6-8-14(18-10)12(16)4-3-5-13(17)15-9-7-11(2)19-15;1-2/h6-9H,3-5H2,1-2H3;1-2H3.
What are the key properties of 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane?
1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane has a molecular weight of 290.36 g/mol, XLogP of 4.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(5-methylfuran-2-yl)pentane-1,5-dione;ethane is sourced from PubChem (CID 144689486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).