About N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane
N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane (PubChem CID 144690114) has the molecular formula C19H33N3O
and a molecular weight of 319.49 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane.
Molecular Properties
| Compound Name | N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane |
| PubChem CID | 144690114 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane |
| SMILES | C=Cc1ccnc(CNCC(=O)N(CC)CC(C)(C)C)c1.CC |
| InChI | InChI=1S/C17H27N3O.C2H6/c1-6-14-8-9-19-15(10-14)11-18-12-16(21)20(7-2)13-17(3,4)5;1-2/h6,8-10,18H,1,7,11-13H2,2-5H3;1-2H3 |
| InChIKey | FWMHCSAHZBAPOA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane?
The IUPAC name of N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane (CID 144690114) is N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane.
What is the SMILES notation for N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane?
The canonical SMILES for N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane is C=Cc1ccnc(CNCC(=O)N(CC)CC(C)(C)C)c1.CC.
What is the InChIKey of N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane?
The InChIKey is FWMHCSAHZBAPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O.C2H6/c1-6-14-8-9-19-15(10-14)11-18-12-16(21)20(7-2)13-17(3,4)5;1-2/h6,8-10,18H,1,7,11-13H2,2-5H3;1-2H3.
What are the key properties of N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane?
N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane has a molecular weight of 319.49 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethylpropyl)-2-[(4-ethenyl-2-pyridinyl)methylamino]-N-ethylacetamide;ethane is sourced from PubChem (CID 144690114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).