About N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine
N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine (PubChem CID 144690483) has the molecular formula C19H37N3
and a molecular weight of 307.53 g/mol. Its IUPAC name is N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine.
Molecular Properties
| Compound Name | N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine |
| PubChem CID | 144690483 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine |
| SMILES | C1CCC(NNC2CCCCC2)CC1.C=NC1CCCCC1 |
| InChI | InChI=1S/C12H24N2.C7H13N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-8-7-5-3-2-4-6-7/h11-14H,1-10H2;7H,1-6H2 |
| InChIKey | XNKSWYCCAGYVLY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine?
The IUPAC name of N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine (CID 144690483) is N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine.
What is the SMILES notation for N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine?
The canonical SMILES for N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine is C1CCC(NNC2CCCCC2)CC1.C=NC1CCCCC1.
What is the InChIKey of N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine?
The InChIKey is XNKSWYCCAGYVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C7H13N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-8-7-5-3-2-4-6-7/h11-14H,1-10H2;7H,1-6H2.
What are the key properties of N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine?
N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine has a molecular weight of 307.53 g/mol, XLogP of 4.77, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylmethanimine;1,2-dicyclohexylhydrazine is sourced from PubChem (CID 144690483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).