About (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane
(1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane (PubChem CID 144690616) has the molecular formula C19H38O3
and a molecular weight of 314.51 g/mol. Its IUPAC name is (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane.
Molecular Properties
| Compound Name | (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane |
| PubChem CID | 144690616 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane |
| SMILES | CC(C)(C)CC(OC=O)OC1CCCCC1.CCC(C)(C)C |
| InChI | InChI=1S/C13H24O3.C6H14/c1-13(2,3)9-12(15-10-14)16-11-7-5-4-6-8-11;1-5-6(2,3)4/h10-12H,4-9H2,1-3H3;5H2,1-4H3 |
| InChIKey | XLDSNHXCFJEAPE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane?
The IUPAC name of (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane (CID 144690616) is (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane.
What is the SMILES notation for (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane?
The canonical SMILES for (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane is CC(C)(C)CC(OC=O)OC1CCCCC1.CCC(C)(C)C.
What is the InChIKey of (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane?
The InChIKey is XLDSNHXCFJEAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3.C6H14/c1-13(2,3)9-12(15-10-14)16-11-7-5-4-6-8-11;1-5-6(2,3)4/h10-12H,4-9H2,1-3H3;5H2,1-4H3.
What are the key properties of (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane?
(1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane has a molecular weight of 314.51 g/mol, XLogP of 5.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane is sourced from PubChem (CID 144690616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).