C19H38O3 — CID 144690616
(1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane (PubChem CID 144690616) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane.
| Compound Name | (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane |
|---|---|
| PubChem CID | 144690616 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | (1-cyclohexyloxy-3,3-dimethylbutyl) formate;2,2-dimethylbutane |
| SMILES | CC(C)(C)CC(OC=O)OC1CCCCC1.CCC(C)(C)C |
| InChI | InChI=1S/C13H24O3.C6H14/c1-13(2,3)9-12(15-10-14)16-11-7-5-4-6-8-11;1-5-6(2,3)4/h10-12H,4-9H2,1-3H3;5H2,1-4H3 |
| InChIKey | XLDSNHXCFJEAPE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|