About methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate
methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate (PubChem CID 144690986) has the molecular formula C13H21FO5
and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate |
| PubChem CID | 144690986 |
| Molecular Formula | C13H21FO5 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)[C@@](C)(F)[C@@H](O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H21FO5/c1-12(14,11(16)17-2)10(15)9-8-18-13(19-9)6-4-3-5-7-13/h9-10,15H,3-8H2,1-2H3/t9-,10+,12+/m1/s1 |
| InChIKey | WSMXVBMCKIGBKC-SCVCMEIPSA-N |
| XLogP | 1.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate?
The IUPAC name of methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate (CID 144690986) is methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate.
What is the SMILES notation for methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate?
The canonical SMILES for methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate is COC(=O)[C@@](C)(F)[C@@H](O)[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate?
The InChIKey is WSMXVBMCKIGBKC-SCVCMEIPSA-N. The full InChI is InChI=1S/C13H21FO5/c1-12(14,11(16)17-2)10(15)9-8-18-13(19-9)6-4-3-5-7-13/h9-10,15H,3-8H2,1-2H3/t9-,10+,12+/m1/s1.
What are the key properties of methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate?
methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate has a molecular weight of 276.30 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S)-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-3-hydroxy-2-methylpropanoate is sourced from PubChem (CID 144690986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).