C25H26ClN3O5 — CID 144691100
(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-2-hydroxy-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile (PubChem CID 144691100) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is (3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-2-hydroxy-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile.
| Compound Name | (3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-2-hydroxy-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 144691100 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-chloro-2-hydroxy-5-(4-morpholin-4-ylphenyl)-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c(O)[nH]c2cc(Cl)c(-c3ccc(N4CCOCC4)cc3)cc12.O[C@@H]1CO[C@@H]2CCOC12 |
| InChI | InChI=1S/C19H16ClN3O2.C6H10O3/c20-17-10-18-15(16(11-21)19(24)22-18)9-14(17)12-1-3-13(4-2-12)23-5-7-25-8-6-23;7-4-3-9-5-1-2-8-6(4)5/h1-4,9-10,22,24H,5-8H2;4-7H,1-3H2/t;4-,5-,6?/m.1/s1 |
| InChIKey | RIOIRHOAYYJDLY-IEDRHCDSSA-N |
| XLogP | 3.44 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |