C22H22N6OS — CID 144691305
4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1H-pyrazole-5-carboxamide (PubChem CID 144691305) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 144691305 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 4-(4,5-dimethyl-1,3-thiazol-2-yl)-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nc(-c2cn[nH]c2C(=O)NC2CCn3cc(-c4ccccc4)nc3C2)sc1C |
| InChI | InChI=1S/C22H22N6OS/c1-13-14(2)30-22(24-13)17-11-23-27-20(17)21(29)25-16-8-9-28-12-18(26-19(28)10-16)15-6-4-3-5-7-15/h3-7,11-12,16H,8-10H2,1-2H3,(H,23,27)(H,25,29) |
| InChIKey | LCKWGNDTVZYNMP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |