C26H33O3S2+ — CID 144691526
(4-cyclohexylsulfonylphenyl)-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylsulfanium;methanol (PubChem CID 144691526) has the molecular formula C26H33O3S2+ and a molecular weight of 457.68 g/mol. Its IUPAC name is (4-cyclohexylsulfonylphenyl)-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylsulfanium;methanol.
| Compound Name | (4-cyclohexylsulfonylphenyl)-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylsulfanium;methanol |
|---|---|
| PubChem CID | 144691526 |
| Molecular Formula | C26H33O3S2+ |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (4-cyclohexylsulfonylphenyl)-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-phenylsulfanium;methanol |
| SMILES | C=C/C=C\C(=C/C)[S+](c1ccccc1)c1ccc(S(=O)(=O)C2CCCCC2)cc1.CO |
| InChI | InChI=1S/C25H29O2S2.CH4O/c1-3-5-12-21(4-2)28(22-13-8-6-9-14-22)23-17-19-25(20-18-23)29(26,27)24-15-10-7-11-16-24;1-2/h3-6,8-9,12-14,17-20,24H,1,7,10-11,15-16H2,2H3;2H,1H3/q+1;/b12-5-,21-4+; |
| InChIKey | CGJVKKSFQVBPID-JTVZTDHESA-N |
| XLogP | 6.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|