C30H33F3N6O — CID 144691896
4-[7-(4-formylphenyl)-5-methylidene-8-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyrimidin-2-yl]benzonitrile;N,N',N'-trimethylethane-1,2-diamine (PubChem CID 144691896) has the molecular formula C30H33F3N6O and a molecular weight of 550.63 g/mol. Its IUPAC name is 4-[7-(4-formylphenyl)-5-methylidene-8-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyrimidin-2-yl]benzonitrile;N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | 4-[7-(4-formylphenyl)-5-methylidene-8-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyrimidin-2-yl]benzonitrile;N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 144691896 |
| Molecular Formula | C30H33F3N6O |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 4-[7-(4-formylphenyl)-5-methylidene-8-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyrimidin-2-yl]benzonitrile;N,N',N'-trimethylethane-1,2-diamine |
| SMILES | C=C1C=C(c2ccc(C=O)cc2)N(CCCC(F)(F)F)c2nc(-c3ccc(C#N)cc3)cn21.CNCCN(C)C |
| InChI | InChI=1S/C25H19F3N4O.C5H14N2/c1-17-13-23(21-9-5-19(16-33)6-10-21)31(12-2-11-25(26,27)28)24-30-22(15-32(17)24)20-7-3-18(14-29)4-8-20;1-6-4-5-7(2)3/h3-10,13,15-16H,1-2,11-12H2;6H,4-5H2,1-3H3 |
| InChIKey | RULQEKADZUXMTF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|