C25H35N9O2 — CID 144691931
N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-1-[2-(4-methylphenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidine-2-carboxamide (PubChem CID 144691931) has the molecular formula C25H35N9O2 and a molecular weight of 493.62 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-1-[2-(4-methylphenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-1-[2-(4-methylphenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144691931 |
| Molecular Formula | C25H35N9O2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N-[(2Z)-2-amino-2-(aminohydrazinylidene)ethyl]-1-[2-(4-methylphenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCCCn1c(N2CCCC2C(=O)NC/C(N)=N/NN)cc(=O)n2cc(-c3ccc(C)cc3)nc12 |
| InChI | InChI=1S/C25H35N9O2/c1-3-4-5-12-33-22(32-13-6-7-20(32)24(36)28-15-21(26)30-31-27)14-23(35)34-16-19(29-25(33)34)18-10-8-17(2)9-11-18/h8-11,14,16,20,31H,3-7,12-13,15,27H2,1-2H3,(H2,26,30)(H,28,36) |
| InChIKey | RKSQTXKLPFQLSI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|