C14H24FN — CID 144692116
4-[(4E,6Z)-5-fluoroocta-4,6-dienyl]-1-methylpiperidine (PubChem CID 144692116) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is 4-[(4E,6Z)-5-fluoroocta-4,6-dienyl]-1-methylpiperidine.
| Compound Name | 4-[(4E,6Z)-5-fluoroocta-4,6-dienyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 144692116 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 4-[(4E,6Z)-5-fluoroocta-4,6-dienyl]-1-methylpiperidine |
| SMILES | C/C=C\C(F)=C/CCCC1CCN(C)CC1 |
| InChI | InChI=1S/C14H24FN/c1-3-6-14(15)8-5-4-7-13-9-11-16(2)12-10-13/h3,6,8,13H,4-5,7,9-12H2,1-2H3/b6-3-,14-8+ |
| InChIKey | CTEATFHTFVLUAE-UARMJIRBSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|