About 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine
4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 144692134) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 144692134 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=C(C)C=C(F)CC1 |
| InChI | InChI=1S/C8H12FN/c1-6-5-7(9)3-4-8(6)10-2/h5,10H,3-4H2,1-2H3 |
| InChIKey | MHXWBPVYZAROKD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine (CID 144692134) is 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine is CNC1=C(C)C=C(F)CC1.
What is the InChIKey of 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine?
The InChIKey is MHXWBPVYZAROKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN/c1-6-5-7(9)3-4-8(6)10-2/h5,10H,3-4H2,1-2H3.
What are the key properties of 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine?
4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine has a molecular weight of 141.19 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N,2-dimethylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 144692134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).