About ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate
ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate (PubChem CID 14469292) has the molecular formula C18H12N4O2
and a molecular weight of 316.32 g/mol. Its IUPAC name is ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate |
| PubChem CID | 14469292 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(C#N)c3nc4ccccc4nc3n2c1 |
| InChI | InChI=1S/C18H12N4O2/c1-2-24-18(23)11-7-8-15-12(9-19)16-17(22(15)10-11)21-14-6-4-3-5-13(14)20-16/h3-8,10H,2H2,1H3 |
| InChIKey | ITNWRNNSZITVFG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate?
The IUPAC name of ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate (CID 14469292) is ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate.
What is the SMILES notation for ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate?
The canonical SMILES for ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate is CCOC(=O)c1ccc2c(C#N)c3nc4ccccc4nc3n2c1.
What is the InChIKey of ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate?
The InChIKey is ITNWRNNSZITVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4O2/c1-2-24-18(23)11-7-8-15-12(9-19)16-17(22(15)10-11)21-14-6-4-3-5-13(14)20-16/h3-8,10H,2H2,1H3.
What are the key properties of ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate?
ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate has a molecular weight of 316.32 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 12-cyanoindolizino[2,3-b]quinoxaline-3-carboxylate is sourced from PubChem (CID 14469292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).