About ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene
ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene (PubChem CID 144693009) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene |
| PubChem CID | 144693009 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene |
| SMILES | CC.COCCOC1=CC=C(C)CC1 |
| InChI | InChI=1S/C10H16O2.C2H6/c1-9-3-5-10(6-4-9)12-8-7-11-2;1-2/h3,5H,4,6-8H2,1-2H3;1-2H3 |
| InChIKey | SHHPVNYBDONCGS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene?
The IUPAC name of ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene (CID 144693009) is ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene.
What is the SMILES notation for ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene?
The canonical SMILES for ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene is CC.COCCOC1=CC=C(C)CC1.
What is the InChIKey of ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene?
The InChIKey is SHHPVNYBDONCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2.C2H6/c1-9-3-5-10(6-4-9)12-8-7-11-2;1-2/h3,5H,4,6-8H2,1-2H3;1-2H3.
What are the key properties of ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene?
ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene has a molecular weight of 198.31 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-methoxyethoxy)-4-methylcyclohexa-1,3-diene is sourced from PubChem (CID 144693009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).