C27H53N3O4 — CID 144693572
N-[1-[[(3R,5S)-5-methoxy-2-methylhexan-3-yl]-(pentoxymethyl)amino]-3-methyl-1-oxopentan-2-yl]-1-methylpiperidine-2-carboxamide (PubChem CID 144693572) has the molecular formula C27H53N3O4 and a molecular weight of 483.74 g/mol. Its IUPAC name is N-[1-[[(3R,5S)-5-methoxy-2-methylhexan-3-yl]-(pentoxymethyl)amino]-3-methyl-1-oxopentan-2-yl]-1-methylpiperidine-2-carboxamide.
| Compound Name | N-[1-[[(3R,5S)-5-methoxy-2-methylhexan-3-yl]-(pentoxymethyl)amino]-3-methyl-1-oxopentan-2-yl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 144693572 |
| Molecular Formula | C27H53N3O4 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.40 |
| IUPAC Name | N-[1-[[(3R,5S)-5-methoxy-2-methylhexan-3-yl]-(pentoxymethyl)amino]-3-methyl-1-oxopentan-2-yl]-1-methylpiperidine-2-carboxamide |
| SMILES | CCCCCOCN(C(=O)C(NC(=O)C1CCCCN1C)C(C)CC)[C@H](C[C@H](C)OC)C(C)C |
| InChI | InChI=1S/C27H53N3O4/c1-9-11-14-17-34-19-30(24(20(3)4)18-22(6)33-8)27(32)25(21(5)10-2)28-26(31)23-15-12-13-16-29(23)7/h20-25H,9-19H2,1-8H3,(H,28,31)/t21?,22-,23?,24+,25?/m0/s1 |
| InChIKey | INEQPYCXDHXKKD-CMZNJMNKSA-N |
| XLogP | 4.44 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|