C12H12N2O5 — CID 144693659
ethyl 1-(2-methoxy-2-oxoethyl)-6-oxocyclopenta[d]pyrazole-3-carboxylate (PubChem CID 144693659) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is ethyl 1-(2-methoxy-2-oxoethyl)-6-oxocyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(2-methoxy-2-oxoethyl)-6-oxocyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 144693659 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl 1-(2-methoxy-2-oxoethyl)-6-oxocyclopenta[d]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(CC(=O)OC)c2c1C=CC2=O |
| InChI | InChI=1S/C12H12N2O5/c1-3-19-12(17)10-7-4-5-8(15)11(7)14(13-10)6-9(16)18-2/h4-5H,3,6H2,1-2H3 |
| InChIKey | QRRSHPYWYKPVDH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |