C13H17ClF3N3O — CID 144693962
4-chloro-1,7-dimethylindazole;ethane;2,2,2-trifluoroacetamide (PubChem CID 144693962) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is 4-chloro-1,7-dimethylindazole;ethane;2,2,2-trifluoroacetamide.
| Compound Name | 4-chloro-1,7-dimethylindazole;ethane;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 144693962 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-chloro-1,7-dimethylindazole;ethane;2,2,2-trifluoroacetamide |
| SMILES | CC.Cc1ccc(Cl)c2cnn(C)c12.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H9ClN2.C2H2F3NO.C2H6/c1-6-3-4-8(10)7-5-11-12(2)9(6)7;3-2(4,5)1(6)7;1-2/h3-5H,1-2H3;(H2,6,7);1-2H3 |
| InChIKey | JDQRCURZULUKDM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |