C18H23N5O10 — CID 144694597
4-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]morpholine-2,2,3,3,5,5,6,6-octol (PubChem CID 144694597) has the molecular formula C18H23N5O10 and a molecular weight of 469.41 g/mol. Its IUPAC name is 4-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]morpholine-2,2,3,3,5,5,6,6-octol.
| Compound Name | 4-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]morpholine-2,2,3,3,5,5,6,6-octol |
|---|---|
| PubChem CID | 144694597 |
| Molecular Formula | C18H23N5O10 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-[6-(2-amino-5-propan-2-yloxybenzenecarboximidoyl)pyrimidin-4-yl]morpholine-2,2,3,3,5,5,6,6-octol |
| SMILES | [H]/N=C(/c1cc(N2C(O)(O)C(O)(O)OC(O)(O)C2(O)O)ncn1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C18H23N5O10/c1-8(2)32-9-3-4-11(19)10(5-9)14(20)12-6-13(22-7-21-12)23-15(24,25)17(28,29)33-18(30,31)16(23,26)27/h3-8,20,24-31H,19H2,1-2H3/b20-14+ |
| InChIKey | CECIKVQLOGEIJC-XSFVSMFZSA-N |
| XLogP | -3.35 |
| TPSA | 259.19 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|