C20H30N6O2 — CID 144695044
4-methoxy-2-[3-[(3S)-4-(1-methoxypropan-2-yl)-3-methylpiperazin-1-yl]-1H-pyrazole-5-carboximidoyl]aniline (PubChem CID 144695044) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 4-methoxy-2-[3-[(3S)-4-(1-methoxypropan-2-yl)-3-methylpiperazin-1-yl]-1H-pyrazole-5-carboximidoyl]aniline.
| Compound Name | 4-methoxy-2-[3-[(3S)-4-(1-methoxypropan-2-yl)-3-methylpiperazin-1-yl]-1H-pyrazole-5-carboximidoyl]aniline |
|---|---|
| PubChem CID | 144695044 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-methoxy-2-[3-[(3S)-4-(1-methoxypropan-2-yl)-3-methylpiperazin-1-yl]-1H-pyrazole-5-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1cc(N2CCN(C(C)COC)[C@@H](C)C2)n[nH]1)c1cc(OC)ccc1N |
| InChI | InChI=1S/C20H30N6O2/c1-13-11-25(7-8-26(13)14(2)12-27-3)19-10-18(23-24-19)20(22)16-9-15(28-4)5-6-17(16)21/h5-6,9-10,13-14,22H,7-8,11-12,21H2,1-4H3,(H,23,24)/b22-20-/t13-,14?/m0/s1 |
| InChIKey | CDAGMUFNVBHMOA-RYFHAOHGSA-N |
| XLogP | 1.96 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|