[(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid

C10H13N3O3 — CID 144695432

IUPAC[(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid
SMILESO=C(O)N[C@@H]1CC[C@@H](n2ncccc2=O)C1
InChIInChI=1S/C10H13N3O3/c14-9-2-1-5-11-13(9)8-4-3-7(6-8)12-10(15)16/h1-2,5,7-8,12H,3-4,6H2,(H,15,16)/t7-,8-/m1/s1
InChIKeyDPYJBQQNYRTCGD-HTQZYQBOSA-N
MW223.23 g/mol
LogP0.60
Rot. Bonds2

About [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid

[(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid (PubChem CID 144695432) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid.

Molecular Properties

Compound Name[(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid
PubChem CID144695432
Molecular FormulaC10H13N3O3
Molecular Weight223.23 g/mol
Exact Mass223.10
IUPAC Name[(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid
SMILESO=C(O)N[C@@H]1CC[C@@H](n2ncccc2=O)C1
InChIInChI=1S/C10H13N3O3/c14-9-2-1-5-11-13(9)8-4-3-7(6-8)12-10(15)16/h1-2,5,7-8,12H,3-4,6H2,(H,15,16)/t7-,8-/m1/s1
InChIKeyDPYJBQQNYRTCGD-HTQZYQBOSA-N
XLogP0.60
TPSA84.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.23
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid?
The IUPAC name of [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid (CID 144695432) is [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid.
What is the SMILES notation for [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid?
The canonical SMILES for [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid is O=C(O)N[C@@H]1CC[C@@H](n2ncccc2=O)C1.
What is the InChIKey of [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid?
The InChIKey is DPYJBQQNYRTCGD-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H13N3O3/c14-9-2-1-5-11-13(9)8-4-3-7(6-8)12-10(15)16/h1-2,5,7-8,12H,3-4,6H2,(H,15,16)/t7-,8-/m1/s1.
What are the key properties of [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid?
[(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid has a molecular weight of 223.23 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3R)-3-(6-oxopyridazin-1-yl)cyclopentyl]carbamic acid is sourced from PubChem (CID 144695432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).