About ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one
ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 144695730) has the molecular formula C11H14FNO
and a molecular weight of 195.24 g/mol. Its IUPAC name is ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 144695730 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CC.O=C1NCCc2cc(F)ccc21 |
| InChI | InChI=1S/C9H8FNO.C2H6/c10-7-1-2-8-6(5-7)3-4-11-9(8)12;1-2/h1-2,5H,3-4H2,(H,11,12);1-2H3 |
| InChIKey | WVNWYYKKLQRWAK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one (CID 144695730) is ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one is CC.O=C1NCCc2cc(F)ccc21.
What is the InChIKey of ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is WVNWYYKKLQRWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO.C2H6/c10-7-1-2-8-6(5-7)3-4-11-9(8)12;1-2/h1-2,5H,3-4H2,(H,11,12);1-2H3.
What are the key properties of ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one?
ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 195.24 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-fluoro-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 144695730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).