C21H29N3O3S — CID 144697590
4-cyclopropylsulfonyl-2-[(2E)-2-[(E)-2-[2-methoxyethyl(methyl)amino]prop-1-enyl]penta-2,4-dienimidoyl]aniline (PubChem CID 144697590) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-2-[(2E)-2-[(E)-2-[2-methoxyethyl(methyl)amino]prop-1-enyl]penta-2,4-dienimidoyl]aniline.
| Compound Name | 4-cyclopropylsulfonyl-2-[(2E)-2-[(E)-2-[2-methoxyethyl(methyl)amino]prop-1-enyl]penta-2,4-dienimidoyl]aniline |
|---|---|
| PubChem CID | 144697590 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 4-cyclopropylsulfonyl-2-[(2E)-2-[(E)-2-[2-methoxyethyl(methyl)amino]prop-1-enyl]penta-2,4-dienimidoyl]aniline |
| SMILES | [H]/N=C(C(=C\C=C)\C=C(/C)N(C)CCOC)/c1cc(S(=O)(=O)C2CC2)ccc1N |
| InChI | InChI=1S/C21H29N3O3S/c1-5-6-16(13-15(2)24(3)11-12-27-4)21(23)19-14-18(9-10-20(19)22)28(25,26)17-7-8-17/h5-6,9-10,13-14,17,23H,1,7-8,11-12,22H2,2-4H3/b15-13+,16-6+,23-21+ |
| InChIKey | QAHXOLUYSMJBDF-DLWKEFOHSA-N |
| XLogP | 3.17 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|