C40H39BF2N4O2 — CID 144697635
5-fluoro-2-[2-(3-fluoroazetidin-1-yl)pyridine-4-carboximidoyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline (PubChem CID 144697635) has the molecular formula C40H39BF2N4O2 and a molecular weight of 656.59 g/mol. Its IUPAC name is 5-fluoro-2-[2-(3-fluoroazetidin-1-yl)pyridine-4-carboximidoyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline.
| Compound Name | 5-fluoro-2-[2-(3-fluoroazetidin-1-yl)pyridine-4-carboximidoyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline |
|---|---|
| PubChem CID | 144697635 |
| Molecular Formula | C40H39BF2N4O2 |
| Molecular Weight | 656.59 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | 5-fluoro-2-[2-(3-fluoroazetidin-1-yl)pyridine-4-carboximidoyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline |
| SMILES | [H]/N=C(\c1ccnc(N2CC(F)C2)c1)c1cc(B2OC(C)(C)C(C)(C)O2)c(F)cc1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H39BF2N4O2/c1-38(2)39(3,4)49-41(48-38)33-23-32(37(44)27-20-21-45-36(22-27)47-25-31(42)26-47)35(24-34(33)43)46-40(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-24,31,44,46H,25-26H2,1-4H3/b44-37+ |
| InChIKey | WNPBSDITXSLDOB-QDIWCCNHSA-N |
| XLogP | 7.50 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|