C21H18N4OSn — CID 144697767
4-[4-(5-pyridin-3-yl-2,1λ2-benzazastannol-3-yl)-2-pyridinyl]morpholine (PubChem CID 144697767) has the molecular formula C21H18N4OSn and a molecular weight of 461.11 g/mol. Its IUPAC name is 4-[4-(5-pyridin-3-yl-2,1λ2-benzazastannol-3-yl)-2-pyridinyl]morpholine.
| Compound Name | 4-[4-(5-pyridin-3-yl-2,1λ2-benzazastannol-3-yl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 144697767 |
| Molecular Formula | C21H18N4OSn |
| Molecular Weight | 461.11 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 4-[4-(5-pyridin-3-yl-2,1λ2-benzazastannol-3-yl)-2-pyridinyl]morpholine |
| SMILES | c1cncc(-c2ccc3c(c2)C(c2ccnc(N4CCOCC4)c2)=N[Sn]3)c1 |
| InChI | InChI=1S/C21H18N4O.Sn/c22-21(17-4-1-3-16(13-17)19-5-2-7-23-15-19)18-6-8-24-20(14-18)25-9-11-26-12-10-25;/h1-3,5-8,13-15H,9-12H2;/q-1;+1 |
| InChIKey | OLCOCFRYGTZXKS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.11 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |