About methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen
methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen (PubChem CID 144697851) has the molecular formula C20H29N5O2
and a molecular weight of 371.49 g/mol. Its IUPAC name is methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen.
Molecular Properties
| Compound Name | methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen |
| PubChem CID | 144697851 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen |
| SMILES | CCOOC.CN1CCN(c2cc(-c3n[nH]c4ccccc34)ccn2)CC1.[H][H] |
| InChI | InChI=1S/C17H19N5.C3H8O2.H2/c1-21-8-10-22(11-9-21)16-12-13(6-7-18-16)17-14-4-2-3-5-15(14)19-20-17;1-3-5-4-2;/h2-7,12H,8-11H2,1H3,(H,19,20);3H2,1-2H3;1H |
| InChIKey | OSJGVMCIWQUZCC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen?
The IUPAC name of methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen (CID 144697851) is methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen.
What is the SMILES notation for methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen?
The canonical SMILES for methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen is CCOOC.CN1CCN(c2cc(-c3n[nH]c4ccccc34)ccn2)CC1.[H][H].
What is the InChIKey of methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen?
The InChIKey is OSJGVMCIWQUZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5.C3H8O2.H2/c1-21-8-10-22(11-9-21)16-12-13(6-7-18-16)17-14-4-2-3-5-15(14)19-20-17;1-3-5-4-2;/h2-7,12H,8-11H2,1H3,(H,19,20);3H2,1-2H3;1H.
What are the key properties of methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen?
methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen has a molecular weight of 371.49 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methylperoxyethane;3-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1H-indazole;molecular hydrogen is sourced from PubChem (CID 144697851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).