C41H42BFN4O3 — CID 144697881
5-fluoro-2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline (PubChem CID 144697881) has the molecular formula C41H42BFN4O3 and a molecular weight of 668.62 g/mol. Its IUPAC name is 5-fluoro-2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline.
| Compound Name | 5-fluoro-2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline |
|---|---|
| PubChem CID | 144697881 |
| Molecular Formula | C41H42BFN4O3 |
| Molecular Weight | 668.62 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | 5-fluoro-2-(2-morpholin-4-ylpyridine-4-carboximidoyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-tritylaniline |
| SMILES | [H]/N=C(\c1ccnc(N2CCOCC2)c1)c1cc(B2OC(C)(C)C(C)(C)O2)c(F)cc1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H42BFN4O3/c1-39(2)40(3,4)50-42(49-39)34-27-33(38(44)29-20-21-45-37(26-29)47-22-24-48-25-23-47)36(28-35(34)43)46-41(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-21,26-28,44,46H,22-25H2,1-4H3/b44-38+ |
| InChIKey | GQBCJHQDCYTTLP-PDHICSTQSA-N |
| XLogP | 7.18 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|