C16H22F2N2O4 — CID 144697957
tert-butyl (3R)-3-[[4-(difluoromethoxy)-2-pyridinyl]oxy]piperidine-1-carboxylate (PubChem CID 144697957) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[4-(difluoromethoxy)-2-pyridinyl]oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[4-(difluoromethoxy)-2-pyridinyl]oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144697957 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | tert-butyl (3R)-3-[[4-(difluoromethoxy)-2-pyridinyl]oxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Oc2cc(OC(F)F)ccn2)C1 |
| InChI | InChI=1S/C16H22F2N2O4/c1-16(2,3)24-15(21)20-8-4-5-12(10-20)22-13-9-11(6-7-19-13)23-14(17)18/h6-7,9,12,14H,4-5,8,10H2,1-3H3/t12-/m1/s1 |
| InChIKey | GDQXGROQVUDLKS-GFCCVEGCSA-N |
| XLogP | 3.46 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |