C25H29FN2O — CID 144698255
ethane;fluoromethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[(E)-2-phenylethenyl]quinazolin-4-one (PubChem CID 144698255) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is ethane;fluoromethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[(E)-2-phenylethenyl]quinazolin-4-one.
| Compound Name | ethane;fluoromethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[(E)-2-phenylethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 144698255 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | ethane;fluoromethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[(E)-2-phenylethenyl]quinazolin-4-one |
| SMILES | C/C=C\C(=C/C)n1c(/C=C/c2ccccc2)nc2ccccc2c1=O.CC.CF |
| InChI | InChI=1S/C22H20N2O.C2H6.CH3F/c1-3-10-18(4-2)24-21(16-15-17-11-6-5-7-12-17)23-20-14-9-8-13-19(20)22(24)25;2*1-2/h3-16H,1-2H3;1-2H3;1H3/b10-3-,16-15+,18-4+;; |
| InChIKey | ZGWKVVFTSFONOJ-APMMBDGXSA-N |
| XLogP | 6.62 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|