About propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol
propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol (PubChem CID 144699261) has the molecular formula C7H15F3N2O2
and a molecular weight of 216.20 g/mol. Its IUPAC name is propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol.
Molecular Properties
| Compound Name | propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol |
| PubChem CID | 144699261 |
| Molecular Formula | C7H15F3N2O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol |
| SMILES | CCC(N)=O.CNCC(O)C(F)(F)F |
| InChI | InChI=1S/C4H8F3NO.C3H7NO/c1-8-2-3(9)4(5,6)7;1-2-3(4)5/h3,8-9H,2H2,1H3;2H2,1H3,(H2,4,5) |
| InChIKey | QLTRYOUFUOHCDN-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol?
The IUPAC name of propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol (CID 144699261) is propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol.
What is the SMILES notation for propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol?
The canonical SMILES for propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol is CCC(N)=O.CNCC(O)C(F)(F)F.
What is the InChIKey of propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol?
The InChIKey is QLTRYOUFUOHCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F3NO.C3H7NO/c1-8-2-3(9)4(5,6)7;1-2-3(4)5/h3,8-9H,2H2,1H3;2H2,1H3,(H2,4,5).
What are the key properties of propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol?
propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol has a molecular weight of 216.20 g/mol, XLogP of 0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;1,1,1-trifluoro-3-(methylamino)propan-2-ol is sourced from PubChem (CID 144699261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).