About spiro[adamantane-2,1'-cyclobutane]
spiro[adamantane-2,1'-cyclobutane] (PubChem CID 14469940) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is spiro[adamantane-2,1'-cyclobutane].
Molecular Properties
| Compound Name | spiro[adamantane-2,1'-cyclobutane] |
| PubChem CID | 14469940 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | spiro[adamantane-2,1'-cyclobutane] |
| SMILES | C1CC2(C1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C13H20/c1-2-13(3-1)11-5-9-4-10(7-11)8-12(13)6-9/h9-12H,1-8H2 |
| InChIKey | AQXKHAYFBDMRAF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[adamantane-2,1'-cyclobutane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[adamantane-2,1'-cyclobutane]?
The IUPAC name of spiro[adamantane-2,1'-cyclobutane] (CID 14469940) is spiro[adamantane-2,1'-cyclobutane].
What is the SMILES notation for spiro[adamantane-2,1'-cyclobutane]?
The canonical SMILES for spiro[adamantane-2,1'-cyclobutane] is C1CC2(C1)C1CC3CC(C1)CC2C3.
What is the InChIKey of spiro[adamantane-2,1'-cyclobutane]?
The InChIKey is AQXKHAYFBDMRAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20/c1-2-13(3-1)11-5-9-4-10(7-11)8-12(13)6-9/h9-12H,1-8H2.
What are the key properties of spiro[adamantane-2,1'-cyclobutane]?
spiro[adamantane-2,1'-cyclobutane] has a molecular weight of 176.30 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[adamantane-2,1'-cyclobutane] is sourced from PubChem (CID 14469940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).