About 4-(3,3-difluorobutyl)piperidin-4-ol;ethane
4-(3,3-difluorobutyl)piperidin-4-ol;ethane (PubChem CID 144699596) has the molecular formula C11H23F2NO
and a molecular weight of 223.31 g/mol. Its IUPAC name is 4-(3,3-difluorobutyl)piperidin-4-ol;ethane.
Molecular Properties
| Compound Name | 4-(3,3-difluorobutyl)piperidin-4-ol;ethane |
| PubChem CID | 144699596 |
| Molecular Formula | C11H23F2NO |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-(3,3-difluorobutyl)piperidin-4-ol;ethane |
| SMILES | CC.CC(F)(F)CCC1(O)CCNCC1 |
| InChI | InChI=1S/C9H17F2NO.C2H6/c1-8(10,11)2-3-9(13)4-6-12-7-5-9;1-2/h12-13H,2-7H2,1H3;1-2H3 |
| InChIKey | PDXMMPFQROCIHI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-difluorobutyl)piperidin-4-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluorobutyl)piperidin-4-ol;ethane?
The IUPAC name of 4-(3,3-difluorobutyl)piperidin-4-ol;ethane (CID 144699596) is 4-(3,3-difluorobutyl)piperidin-4-ol;ethane.
What is the SMILES notation for 4-(3,3-difluorobutyl)piperidin-4-ol;ethane?
The canonical SMILES for 4-(3,3-difluorobutyl)piperidin-4-ol;ethane is CC.CC(F)(F)CCC1(O)CCNCC1.
What is the InChIKey of 4-(3,3-difluorobutyl)piperidin-4-ol;ethane?
The InChIKey is PDXMMPFQROCIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO.C2H6/c1-8(10,11)2-3-9(13)4-6-12-7-5-9;1-2/h12-13H,2-7H2,1H3;1-2H3.
What are the key properties of 4-(3,3-difluorobutyl)piperidin-4-ol;ethane?
4-(3,3-difluorobutyl)piperidin-4-ol;ethane has a molecular weight of 223.31 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluorobutyl)piperidin-4-ol;ethane is sourced from PubChem (CID 144699596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).