About 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol
4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol (PubChem CID 144699623) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol |
| PubChem CID | 144699623 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol |
| SMILES | CN1CCC(O)(CCC(C)(F)F)CC1 |
| InChI | InChI=1S/C10H19F2NO/c1-9(11,12)3-4-10(14)5-7-13(2)8-6-10/h14H,3-8H2,1-2H3 |
| InChIKey | OHKVNJTWORMWSG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol?
The IUPAC name of 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol (CID 144699623) is 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol.
What is the SMILES notation for 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol?
The canonical SMILES for 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol is CN1CCC(O)(CCC(C)(F)F)CC1.
What is the InChIKey of 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol?
The InChIKey is OHKVNJTWORMWSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO/c1-9(11,12)3-4-10(14)5-7-13(2)8-6-10/h14H,3-8H2,1-2H3.
What are the key properties of 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol?
4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol has a molecular weight of 207.26 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-difluorobutyl)-1-methylpiperidin-4-ol is sourced from PubChem (CID 144699623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).