About N-methylpropanamide
N-methylpropanamide (PubChem CID 14470) has the molecular formula C4H9NO
and a molecular weight of 87.12 g/mol. Its IUPAC name is N-methylpropanamide.
Molecular Properties
| Compound Name | N-methylpropanamide |
| PubChem CID | 14470 |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.07 |
| IUPAC Name | N-methylpropanamide |
| SMILES | CCC(=O)NC |
| InChI | InChI=1S/C4H9NO/c1-3-4(6)5-2/h3H2,1-2H3,(H,5,6) |
| InChIKey | QJQAMHYHNCADNR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.12 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropanamide?
The IUPAC name of N-methylpropanamide (CID 14470) is N-methylpropanamide.
What is the SMILES notation for N-methylpropanamide?
The canonical SMILES for N-methylpropanamide is CCC(=O)NC.
What is the InChIKey of N-methylpropanamide?
The InChIKey is QJQAMHYHNCADNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO/c1-3-4(6)5-2/h3H2,1-2H3,(H,5,6).
What are the key properties of N-methylpropanamide?
N-methylpropanamide has a molecular weight of 87.12 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropanamide is sourced from PubChem (CID 14470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).